C30H31F2N5O3Si — CID 123989574
[5-amino-1-[4-(2,3-difluorophenoxy)-2-methylphenyl]pyrazol-4-yl]-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methanone (PubChem CID 123989574) has the molecular formula C30H31F2N5O3Si and a molecular weight of 575.69 g/mol. Its IUPAC name is [5-amino-1-[4-(2,3-difluorophenoxy)-2-methylphenyl]pyrazol-4-yl]-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methanone.
| Compound Name | [5-amino-1-[4-(2,3-difluorophenoxy)-2-methylphenyl]pyrazol-4-yl]-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methanone |
|---|---|
| PubChem CID | 123989574 |
| Molecular Formula | C30H31F2N5O3Si |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | [5-amino-1-[4-(2,3-difluorophenoxy)-2-methylphenyl]pyrazol-4-yl]-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methanone |
| SMILES | Cc1cc(Oc2cccc(F)c2F)ccc1-n1ncc(C(=O)c2nc3ccccc3n2COCC[Si](C)(C)C)c1N |
| InChI | InChI=1S/C30H31F2N5O3Si/c1-19-16-20(40-26-11-7-8-22(31)27(26)32)12-13-24(19)37-29(33)21(17-34-37)28(38)30-35-23-9-5-6-10-25(23)36(30)18-39-14-15-41(2,3)4/h5-13,16-17H,14-15,18,33H2,1-4H3 |
| InChIKey | ASNFJASDLURWCU-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|