C26H22F2N6O3S — CID 146258169
[5-amino-1-[4-(2-fluorophenoxy)-2-methylphenyl]pyrazol-4-yl]-[5-fluoro-6-[(methoxyamino)sulfanylamino]-1H-indol-2-yl]methanone (PubChem CID 146258169) has the molecular formula C26H22F2N6O3S and a molecular weight of 536.56 g/mol. Its IUPAC name is [5-amino-1-[4-(2-fluorophenoxy)-2-methylphenyl]pyrazol-4-yl]-[5-fluoro-6-[(methoxyamino)sulfanylamino]-1H-indol-2-yl]methanone.
| Compound Name | [5-amino-1-[4-(2-fluorophenoxy)-2-methylphenyl]pyrazol-4-yl]-[5-fluoro-6-[(methoxyamino)sulfanylamino]-1H-indol-2-yl]methanone |
|---|---|
| PubChem CID | 146258169 |
| Molecular Formula | C26H22F2N6O3S |
| Molecular Weight | 536.56 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | [5-amino-1-[4-(2-fluorophenoxy)-2-methylphenyl]pyrazol-4-yl]-[5-fluoro-6-[(methoxyamino)sulfanylamino]-1H-indol-2-yl]methanone |
| SMILES | CONSNc1cc2[nH]c(C(=O)c3cnn(-c4ccc(Oc5ccccc5F)cc4C)c3N)cc2cc1F |
| InChI | InChI=1S/C26H22F2N6O3S/c1-14-9-16(37-24-6-4-3-5-18(24)27)7-8-23(14)34-26(29)17(13-30-34)25(35)22-11-15-10-19(28)21(12-20(15)31-22)32-38-33-36-2/h3-13,31-33H,29H2,1-2H3 |
| InChIKey | RWXYMLXVKBJPLI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.56 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|