C31H29F3N6O5S — CID 137359121
[5-amino-1-[4-(2-fluorophenoxy)-2-methylphenyl]pyrazol-4-yl]-[5-(2,2-difluoroethoxy)-6-(4,4-dimethyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)-1H-indol-2-yl]methanone (PubChem CID 137359121) has the molecular formula C31H29F3N6O5S and a molecular weight of 654.67 g/mol. Its IUPAC name is [5-amino-1-[4-(2-fluorophenoxy)-2-methylphenyl]pyrazol-4-yl]-[5-(2,2-difluoroethoxy)-6-(4,4-dimethyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)-1H-indol-2-yl]methanone.
| Compound Name | [5-amino-1-[4-(2-fluorophenoxy)-2-methylphenyl]pyrazol-4-yl]-[5-(2,2-difluoroethoxy)-6-(4,4-dimethyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)-1H-indol-2-yl]methanone |
|---|---|
| PubChem CID | 137359121 |
| Molecular Formula | C31H29F3N6O5S |
| Molecular Weight | 654.67 g/mol |
| Exact Mass | 654.19 |
| IUPAC Name | [5-amino-1-[4-(2-fluorophenoxy)-2-methylphenyl]pyrazol-4-yl]-[5-(2,2-difluoroethoxy)-6-(4,4-dimethyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)-1H-indol-2-yl]methanone |
| SMILES | Cc1cc(Oc2ccccc2F)ccc1-n1ncc(C(=O)c2cc3cc(OCC(F)F)c(N4CC(C)(C)NS4(=O)=O)cc3[nH]2)c1N |
| InChI | InChI=1S/C31H29F3N6O5S/c1-17-10-19(45-26-7-5-4-6-21(26)32)8-9-24(17)40-30(35)20(14-36-40)29(41)23-11-18-12-27(44-15-28(33)34)25(13-22(18)37-23)39-16-31(2,3)38-46(39,42)43/h4-14,28,37-38H,15-16,35H2,1-3H3 |
| InChIKey | ANCJXASVECCGCC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 144.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.67 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |