C26H22F2N6O4S — CID 145211283
[2-[5-amino-1-[4-(2-fluorophenoxy)-2-methylphenyl]pyrazole-4-carbonyl]-6-[(methoxyamino)sulfanylamino]-1H-indol-5-yl] hypofluorite (PubChem CID 145211283) has the molecular formula C26H22F2N6O4S and a molecular weight of 552.56 g/mol. Its IUPAC name is [2-[5-amino-1-[4-(2-fluorophenoxy)-2-methylphenyl]pyrazole-4-carbonyl]-6-[(methoxyamino)sulfanylamino]-1H-indol-5-yl] hypofluorite.
| Compound Name | [2-[5-amino-1-[4-(2-fluorophenoxy)-2-methylphenyl]pyrazole-4-carbonyl]-6-[(methoxyamino)sulfanylamino]-1H-indol-5-yl] hypofluorite |
|---|---|
| PubChem CID | 145211283 |
| Molecular Formula | C26H22F2N6O4S |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | [2-[5-amino-1-[4-(2-fluorophenoxy)-2-methylphenyl]pyrazole-4-carbonyl]-6-[(methoxyamino)sulfanylamino]-1H-indol-5-yl] hypofluorite |
| SMILES | CONSNc1cc2[nH]c(C(=O)c3cnn(-c4ccc(Oc5ccccc5F)cc4C)c3N)cc2cc1OF |
| InChI | InChI=1S/C26H22F2N6O4S/c1-14-9-16(37-23-6-4-3-5-18(23)27)7-8-22(14)34-26(29)17(13-30-34)25(35)21-10-15-11-24(38-28)20(12-19(15)31-21)32-39-33-36-2/h3-13,31-33H,29H2,1-2H3 |
| InChIKey | YSEJCZSXGNNHCY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|