About 3-amino-N-(N'-methylcarbamimidoyl)propanamide
3-amino-N-(N'-methylcarbamimidoyl)propanamide (PubChem CID 123176626) has the molecular formula C5H12N4O
and a molecular weight of 144.18 g/mol. Its IUPAC name is 3-amino-N-(N'-methylcarbamimidoyl)propanamide.
Molecular Properties
| Compound Name | 3-amino-N-(N'-methylcarbamimidoyl)propanamide |
| PubChem CID | 123176626 |
| Molecular Formula | C5H12N4O |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | 3-amino-N-(N'-methylcarbamimidoyl)propanamide |
| SMILES | C/N=C(\N)NC(=O)CCN |
| InChI | InChI=1S/C5H12N4O/c1-8-5(7)9-4(10)2-3-6/h2-3,6H2,1H3,(H3,7,8,9,10) |
| InChIKey | HDKIJPLETKRSLT-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N-(N'-methylcarbamimidoyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(N'-methylcarbamimidoyl)propanamide?
The IUPAC name of 3-amino-N-(N'-methylcarbamimidoyl)propanamide (CID 123176626) is 3-amino-N-(N'-methylcarbamimidoyl)propanamide.
What is the SMILES notation for 3-amino-N-(N'-methylcarbamimidoyl)propanamide?
The canonical SMILES for 3-amino-N-(N'-methylcarbamimidoyl)propanamide is C/N=C(\N)NC(=O)CCN.
What is the InChIKey of 3-amino-N-(N'-methylcarbamimidoyl)propanamide?
The InChIKey is HDKIJPLETKRSLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N4O/c1-8-5(7)9-4(10)2-3-6/h2-3,6H2,1H3,(H3,7,8,9,10).
What are the key properties of 3-amino-N-(N'-methylcarbamimidoyl)propanamide?
3-amino-N-(N'-methylcarbamimidoyl)propanamide has a molecular weight of 144.18 g/mol, XLogP of -1.60, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(N'-methylcarbamimidoyl)propanamide is sourced from PubChem (CID 123176626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).