C5H9N5O — CID 139220797
2-(6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)guanidine (PubChem CID 139220797) has the molecular formula C5H9N5O and a molecular weight of 155.16 g/mol. Its IUPAC name is 2-(6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)guanidine.
| Compound Name | 2-(6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)guanidine |
|---|---|
| PubChem CID | 139220797 |
| Molecular Formula | C5H9N5O |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 2-(6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)guanidine |
| SMILES | NC(N)=NC1=NCCC(=O)N1 |
| InChI | InChI=1S/C5H9N5O/c6-4(7)10-5-8-2-1-3(11)9-5/h1-2H2,(H5,6,7,8,9,10,11) |
| InChIKey | RWUTWOOTHXITPG-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|