C14H13N5O — CID 123176707
3-(1H-indol-2-yl)-5-(methylamino)pyrazine-2-carboxamide (PubChem CID 123176707) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 3-(1H-indol-2-yl)-5-(methylamino)pyrazine-2-carboxamide.
| Compound Name | 3-(1H-indol-2-yl)-5-(methylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 123176707 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 3-(1H-indol-2-yl)-5-(methylamino)pyrazine-2-carboxamide |
| SMILES | CNc1cnc(C(N)=O)c(-c2cc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C14H13N5O/c1-16-11-7-17-13(14(15)20)12(19-11)10-6-8-4-2-3-5-9(8)18-10/h2-7,18H,1H3,(H2,15,20)(H,16,19) |
| InChIKey | WIPWZHNXXOPTOE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |