C19H22N6O — CID 102532139
5-[[(1R,2S)-2-aminocyclohexyl]amino]-3-(1H-indol-2-yl)pyrazine-2-carboxamide (PubChem CID 102532139) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is 5-[[(1R,2S)-2-aminocyclohexyl]amino]-3-(1H-indol-2-yl)pyrazine-2-carboxamide.
| Compound Name | 5-[[(1R,2S)-2-aminocyclohexyl]amino]-3-(1H-indol-2-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 102532139 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 5-[[(1R,2S)-2-aminocyclohexyl]amino]-3-(1H-indol-2-yl)pyrazine-2-carboxamide |
| SMILES | NC(=O)c1ncc(N[C@@H]2CCCC[C@@H]2N)nc1-c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H22N6O/c20-12-6-2-4-8-14(12)24-16-10-22-18(19(21)26)17(25-16)15-9-11-5-1-3-7-13(11)23-15/h1,3,5,7,9-10,12,14,23H,2,4,6,8,20H2,(H2,21,26)(H,24,25)/t12-,14+/m0/s1 |
| InChIKey | YACNMLLIRLXUQZ-GXTWGEPZSA-N |
| XLogP | 2.41 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |