C28H46O3 — CID 123176724
1-cyclohex-2-en-1-ylethyl 2-[7-(2,2-dimethylpropyl)-8,8-dimethyl-6-methylidenedeca-2,4-dien-3-yl]oxyacetate (PubChem CID 123176724) has the molecular formula C28H46O3 and a molecular weight of 430.67 g/mol. Its IUPAC name is 1-cyclohex-2-en-1-ylethyl 2-[7-(2,2-dimethylpropyl)-8,8-dimethyl-6-methylidenedeca-2,4-dien-3-yl]oxyacetate.
| Compound Name | 1-cyclohex-2-en-1-ylethyl 2-[7-(2,2-dimethylpropyl)-8,8-dimethyl-6-methylidenedeca-2,4-dien-3-yl]oxyacetate |
|---|---|
| PubChem CID | 123176724 |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | 1-cyclohex-2-en-1-ylethyl 2-[7-(2,2-dimethylpropyl)-8,8-dimethyl-6-methylidenedeca-2,4-dien-3-yl]oxyacetate |
| SMILES | C=C(C=CC(=CC)OCC(=O)OC(C)C1C=CCCC1)C(CC(C)(C)C)C(C)(C)CC |
| InChI | InChI=1S/C28H46O3/c1-10-24(30-20-26(29)31-22(4)23-15-13-12-14-16-23)18-17-21(3)25(19-27(5,6)7)28(8,9)11-2/h10,13,15,17-18,22-23,25H,3,11-12,14,16,19-20H2,1-2,4-9H3 |
| InChIKey | IKYOPFGABJVDNY-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|