C16H21N5O2 — CID 1231769
3-cyclopentyl-N-[3-methoxy-5-(tetrazol-1-yl)phenyl]propanamide (PubChem CID 1231769) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 3-cyclopentyl-N-[3-methoxy-5-(tetrazol-1-yl)phenyl]propanamide.
| Compound Name | 3-cyclopentyl-N-[3-methoxy-5-(tetrazol-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 1231769 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 3-cyclopentyl-N-[3-methoxy-5-(tetrazol-1-yl)phenyl]propanamide |
| SMILES | COc1cc(NC(=O)CCC2CCCC2)cc(-n2cnnn2)c1 |
| InChI | InChI=1S/C16H21N5O2/c1-23-15-9-13(8-14(10-15)21-11-17-19-20-21)18-16(22)7-6-12-4-2-3-5-12/h8-12H,2-7H2,1H3,(H,18,22) |
| InChIKey | LOLOMNWJVUMOSO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |