C13H11N5O3 — CID 4155435
N-[3-methoxy-5-(tetrazol-1-yl)phenyl]furan-2-carboxamide (PubChem CID 4155435) has the molecular formula C13H11N5O3 and a molecular weight of 285.26 g/mol. Its IUPAC name is N-[3-methoxy-5-(tetrazol-1-yl)phenyl]furan-2-carboxamide.
| Compound Name | N-[3-methoxy-5-(tetrazol-1-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4155435 |
| Molecular Formula | C13H11N5O3 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-[3-methoxy-5-(tetrazol-1-yl)phenyl]furan-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccco2)cc(-n2cnnn2)c1 |
| InChI | InChI=1S/C13H11N5O3/c1-20-11-6-9(15-13(19)12-3-2-4-21-12)5-10(7-11)18-8-14-16-17-18/h2-8H,1H3,(H,15,19) |
| InChIKey | LAUVUCCLBJVMAI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |