C17H19ClN6O2 — CID 154912324
4-(2-aminoethyl)-N-[3-methoxy-5-(tetrazol-1-yl)phenyl]benzamide;hydrochloride (PubChem CID 154912324) has the molecular formula C17H19ClN6O2 and a molecular weight of 374.83 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N-[3-methoxy-5-(tetrazol-1-yl)phenyl]benzamide;hydrochloride.
| Compound Name | 4-(2-aminoethyl)-N-[3-methoxy-5-(tetrazol-1-yl)phenyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 154912324 |
| Molecular Formula | C17H19ClN6O2 |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 4-(2-aminoethyl)-N-[3-methoxy-5-(tetrazol-1-yl)phenyl]benzamide;hydrochloride |
| SMILES | COc1cc(NC(=O)c2ccc(CCN)cc2)cc(-n2cnnn2)c1.Cl |
| InChI | InChI=1S/C17H18N6O2.ClH/c1-25-16-9-14(8-15(10-16)23-11-19-21-22-23)20-17(24)13-4-2-12(3-5-13)6-7-18;/h2-5,8-11H,6-7,18H2,1H3,(H,20,24);1H |
| InChIKey | YZYPWMZGBYZFNQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |