C16H18N8O2 — CID 131935094
2-(dimethylamino)-N-[3-methoxy-5-(tetrazol-1-yl)phenyl]-4-methylpyrimidine-5-carboxamide (PubChem CID 131935094) has the molecular formula C16H18N8O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[3-methoxy-5-(tetrazol-1-yl)phenyl]-4-methylpyrimidine-5-carboxamide.
| Compound Name | 2-(dimethylamino)-N-[3-methoxy-5-(tetrazol-1-yl)phenyl]-4-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 131935094 |
| Molecular Formula | C16H18N8O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-(dimethylamino)-N-[3-methoxy-5-(tetrazol-1-yl)phenyl]-4-methylpyrimidine-5-carboxamide |
| SMILES | COc1cc(NC(=O)c2cnc(N(C)C)nc2C)cc(-n2cnnn2)c1 |
| InChI | InChI=1S/C16H18N8O2/c1-10-14(8-17-16(19-10)23(2)3)15(25)20-11-5-12(7-13(6-11)26-4)24-9-18-21-22-24/h5-9H,1-4H3,(H,20,25) |
| InChIKey | VFZQBCVRHDDCFD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 110.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |