C18H23N7O2 — CID 131924947
1-ethyl-N-[3-methoxy-5-(tetrazol-1-yl)phenyl]-3-(2-methylpropyl)pyrazole-5-carboxamide (PubChem CID 131924947) has the molecular formula C18H23N7O2 and a molecular weight of 369.43 g/mol. Its IUPAC name is 1-ethyl-N-[3-methoxy-5-(tetrazol-1-yl)phenyl]-3-(2-methylpropyl)pyrazole-5-carboxamide.
| Compound Name | 1-ethyl-N-[3-methoxy-5-(tetrazol-1-yl)phenyl]-3-(2-methylpropyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 131924947 |
| Molecular Formula | C18H23N7O2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 1-ethyl-N-[3-methoxy-5-(tetrazol-1-yl)phenyl]-3-(2-methylpropyl)pyrazole-5-carboxamide |
| SMILES | CCn1nc(CC(C)C)cc1C(=O)Nc1cc(OC)cc(-n2cnnn2)c1 |
| InChI | InChI=1S/C18H23N7O2/c1-5-24-17(9-14(21-24)6-12(2)3)18(26)20-13-7-15(10-16(8-13)27-4)25-11-19-22-23-25/h7-12H,5-6H2,1-4H3,(H,20,26) |
| InChIKey | MTGFQEJHPMZCHQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |