C20H30N6O4 — CID 154915325
formic acid;N-[3-methoxy-5-(tetrazol-1-yl)phenyl]-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide (PubChem CID 154915325) has the molecular formula C20H30N6O4 and a molecular weight of 418.50 g/mol. Its IUPAC name is formic acid;N-[3-methoxy-5-(tetrazol-1-yl)phenyl]-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide.
| Compound Name | formic acid;N-[3-methoxy-5-(tetrazol-1-yl)phenyl]-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 154915325 |
| Molecular Formula | C20H30N6O4 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | formic acid;N-[3-methoxy-5-(tetrazol-1-yl)phenyl]-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
| SMILES | COc1cc(NC(=O)CC2CC(C)(C)NC(C)(C)C2)cc(-n2cnnn2)c1.O=CO |
| InChI | InChI=1S/C19H28N6O2.CH2O2/c1-18(2)10-13(11-19(3,4)22-18)6-17(26)21-14-7-15(9-16(8-14)27-5)25-12-20-23-24-25;2-1-3/h7-9,12-13,22H,6,10-11H2,1-5H3,(H,21,26);1H,(H,2,3) |
| InChIKey | UNXXDCOFCKDVAY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|