C12H25ClO — CID 123177115
1-chloro-4-methoxy-2,4-dimethyl-3-propan-2-ylhexane (PubChem CID 123177115) has the molecular formula C12H25ClO and a molecular weight of 220.78 g/mol. Its IUPAC name is 1-chloro-4-methoxy-2,4-dimethyl-3-propan-2-ylhexane.
| Compound Name | 1-chloro-4-methoxy-2,4-dimethyl-3-propan-2-ylhexane |
|---|---|
| PubChem CID | 123177115 |
| Molecular Formula | C12H25ClO |
| Molecular Weight | 220.78 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 1-chloro-4-methoxy-2,4-dimethyl-3-propan-2-ylhexane |
| SMILES | CCC(C)(OC)C(C(C)C)C(C)CCl |
| InChI | InChI=1S/C12H25ClO/c1-7-12(5,14-6)11(9(2)3)10(4)8-13/h9-11H,7-8H2,1-6H3 |
| InChIKey | RANLJBNOKSDAJO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.78 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|