C8H8FN3 — CID 123180526
1-(5-fluoro-2-pyridinyl)-N-methylethane-1,2-diimine (PubChem CID 123180526) has the molecular formula C8H8FN3 and a molecular weight of 165.17 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-N-methylethane-1,2-diimine.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-N-methylethane-1,2-diimine |
|---|---|
| PubChem CID | 123180526 |
| Molecular Formula | C8H8FN3 |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-N-methylethane-1,2-diimine |
| SMILES | [H]/N=C/C(=N\C)c1ccc(F)cn1 |
| InChI | InChI=1S/C8H8FN3/c1-11-8(4-10)7-3-2-6(9)5-12-7/h2-5,10H,1H3/b10-4+,11-8+ |
| InChIKey | LCXHSXSAUSERDK-HZLOGALDSA-N |
| XLogP | 1.29 |
| TPSA | 49.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|