1-tetracyclo[5.2.1.03,8.05,8]decanyl 2-methyl-4-phenylbutanoate

C21H26O2 — CID 123181580

IUPAC1-tetracyclo[5.2.1.03,8.05,8]decanyl 2-methyl-4-phenylbutanoate
SMILESCC(CCc1ccccc1)C(=O)OC12CC3CC4CC(C1)C43C2
InChIInChI=1S/C21H26O2/c1-14(7-8-15-5-3-2-4-6-15)19(22)23-20-11-17-9-16-10-18(12-20)21(16,17)13-20/h2-6,14,16-18H,7-13H2,1H3
InChIKeyDFRUYNKZWIUCAS-UHFFFAOYSA-N
MW310.44 g/mol
LogP4.38
Rot. Bonds5

About 1-tetracyclo[5.2.1.03,8.05,8]decanyl 2-methyl-4-phenylbutanoate

1-tetracyclo[5.2.1.03,8.05,8]decanyl 2-methyl-4-phenylbutanoate (PubChem CID 123181580) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-tetracyclo[5.2.1.03,8.05,8]decanyl 2-methyl-4-phenylbutanoate.

Molecular Properties

Compound Name1-tetracyclo[5.2.1.03,8.05,8]decanyl 2-methyl-4-phenylbutanoate
PubChem CID123181580
Molecular FormulaC21H26O2
Molecular Weight310.44 g/mol
Exact Mass310.19
IUPAC Name1-tetracyclo[5.2.1.03,8.05,8]decanyl 2-methyl-4-phenylbutanoate
SMILESCC(CCc1ccccc1)C(=O)OC12CC3CC4CC(C1)C43C2
InChIInChI=1S/C21H26O2/c1-14(7-8-15-5-3-2-4-6-15)19(22)23-20-11-17-9-16-10-18(12-20)21(16,17)13-20/h2-6,14,16-18H,7-13H2,1H3
InChIKeyDFRUYNKZWIUCAS-UHFFFAOYSA-N
XLogP4.38
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.44
LogP ≤ 54.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 1-tetracyclo[5.2.1.03,8.05,8]decanyl 2-methyl-4-phenylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-tetracyclo[5.2.1.03,8.05,8]decanyl 2-methyl-4-phenylbutanoate?
The IUPAC name of 1-tetracyclo[5.2.1.03,8.05,8]decanyl 2-methyl-4-phenylbutanoate (CID 123181580) is 1-tetracyclo[5.2.1.03,8.05,8]decanyl 2-methyl-4-phenylbutanoate.
What is the SMILES notation for 1-tetracyclo[5.2.1.03,8.05,8]decanyl 2-methyl-4-phenylbutanoate?
The canonical SMILES for 1-tetracyclo[5.2.1.03,8.05,8]decanyl 2-methyl-4-phenylbutanoate is CC(CCc1ccccc1)C(=O)OC12CC3CC4CC(C1)C43C2.
What is the InChIKey of 1-tetracyclo[5.2.1.03,8.05,8]decanyl 2-methyl-4-phenylbutanoate?
The InChIKey is DFRUYNKZWIUCAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26O2/c1-14(7-8-15-5-3-2-4-6-15)19(22)23-20-11-17-9-16-10-18(12-20)21(16,17)13-20/h2-6,14,16-18H,7-13H2,1H3.
What are the key properties of 1-tetracyclo[5.2.1.03,8.05,8]decanyl 2-methyl-4-phenylbutanoate?
1-tetracyclo[5.2.1.03,8.05,8]decanyl 2-methyl-4-phenylbutanoate has a molecular weight of 310.44 g/mol, XLogP of 4.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tetracyclo[5.2.1.03,8.05,8]decanyl 2-methyl-4-phenylbutanoate is sourced from PubChem (CID 123181580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).