C24H23N3O2S — CID 123181797
9-(4-aminobenzoyl)-N-cyclopropyl-3-thia-9-azatricyclo[8.5.0.02,6]pentadeca-1(10),2(6),4,11,14-pentaene-4-carboxamide (PubChem CID 123181797) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is 9-(4-aminobenzoyl)-N-cyclopropyl-3-thia-9-azatricyclo[8.5.0.02,6]pentadeca-1(10),2(6),4,11,14-pentaene-4-carboxamide.
| Compound Name | 9-(4-aminobenzoyl)-N-cyclopropyl-3-thia-9-azatricyclo[8.5.0.02,6]pentadeca-1(10),2(6),4,11,14-pentaene-4-carboxamide |
|---|---|
| PubChem CID | 123181797 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 9-(4-aminobenzoyl)-N-cyclopropyl-3-thia-9-azatricyclo[8.5.0.02,6]pentadeca-1(10),2(6),4,11,14-pentaene-4-carboxamide |
| SMILES | Nc1ccc(C(=O)N2CCc3cc(C(=O)NC4CC4)sc3C3=C2C=CCC=C3)cc1 |
| InChI | InChI=1S/C24H23N3O2S/c25-17-8-6-15(7-9-17)24(29)27-13-12-16-14-21(23(28)26-18-10-11-18)30-22(16)19-4-2-1-3-5-20(19)27/h2-9,14,18H,1,10-13,25H2,(H,26,28) |
| InChIKey | SKASMGCNTYSJJC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|