C26H20FN3O2S — CID 137391360
6-(4-aminobenzoyl)-8-fluoro-N-phenyl-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxamide (PubChem CID 137391360) has the molecular formula C26H20FN3O2S and a molecular weight of 457.53 g/mol. Its IUPAC name is 6-(4-aminobenzoyl)-8-fluoro-N-phenyl-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxamide.
| Compound Name | 6-(4-aminobenzoyl)-8-fluoro-N-phenyl-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxamide |
|---|---|
| PubChem CID | 137391360 |
| Molecular Formula | C26H20FN3O2S |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 6-(4-aminobenzoyl)-8-fluoro-N-phenyl-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxamide |
| SMILES | Nc1ccc(C(=O)N2CCc3cc(C(=O)Nc4ccccc4)sc3-c3ccc(F)cc32)cc1 |
| InChI | InChI=1S/C26H20FN3O2S/c27-18-8-11-21-22(15-18)30(26(32)16-6-9-19(28)10-7-16)13-12-17-14-23(33-24(17)21)25(31)29-20-4-2-1-3-5-20/h1-11,14-15H,12-13,28H2,(H,29,31) |
| InChIKey | BGCATHPJJDVXRN-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|