C12H17ClO4 — CID 123181972
ethyl 5-(3-chloropenta-2,4-dien-2-yl)-2-methyl-1,3-dioxolane-4-carboxylate (PubChem CID 123181972) has the molecular formula C12H17ClO4 and a molecular weight of 260.72 g/mol. Its IUPAC name is ethyl 5-(3-chloropenta-2,4-dien-2-yl)-2-methyl-1,3-dioxolane-4-carboxylate.
| Compound Name | ethyl 5-(3-chloropenta-2,4-dien-2-yl)-2-methyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 123181972 |
| Molecular Formula | C12H17ClO4 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | ethyl 5-(3-chloropenta-2,4-dien-2-yl)-2-methyl-1,3-dioxolane-4-carboxylate |
| SMILES | C=CC(Cl)=C(C)C1OC(C)OC1C(=O)OCC |
| InChI | InChI=1S/C12H17ClO4/c1-5-9(13)7(3)10-11(12(14)15-6-2)17-8(4)16-10/h5,8,10-11H,1,6H2,2-4H3 |
| InChIKey | GTVPNVILUSOZRQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|