C16H25ClO4 — CID 123333370
methyl 5-(2-chlorohepta-2,4-dien-3-yl)-2,2-diethyl-1,3-dioxolane-4-carboxylate (PubChem CID 123333370) has the molecular formula C16H25ClO4 and a molecular weight of 316.83 g/mol. Its IUPAC name is methyl 5-(2-chlorohepta-2,4-dien-3-yl)-2,2-diethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl 5-(2-chlorohepta-2,4-dien-3-yl)-2,2-diethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 123333370 |
| Molecular Formula | C16H25ClO4 |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | methyl 5-(2-chlorohepta-2,4-dien-3-yl)-2,2-diethyl-1,3-dioxolane-4-carboxylate |
| SMILES | CCC=CC(=C(C)Cl)C1OC(CC)(CC)OC1C(=O)OC |
| InChI | InChI=1S/C16H25ClO4/c1-6-9-10-12(11(4)17)13-14(15(18)19-5)21-16(7-2,8-3)20-13/h9-10,13-14H,6-8H2,1-5H3 |
| InChIKey | QNSXYAXZMRBSOK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|