C17H24Cl2O4 — CID 123349374
ethyl 5-(2,4-dichlorohepta-2,4,6-trien-3-yl)-2,2-diethyl-1,3-dioxolane-4-carboxylate (PubChem CID 123349374) has the molecular formula C17H24Cl2O4 and a molecular weight of 363.28 g/mol. Its IUPAC name is ethyl 5-(2,4-dichlorohepta-2,4,6-trien-3-yl)-2,2-diethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | ethyl 5-(2,4-dichlorohepta-2,4,6-trien-3-yl)-2,2-diethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 123349374 |
| Molecular Formula | C17H24Cl2O4 |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | ethyl 5-(2,4-dichlorohepta-2,4,6-trien-3-yl)-2,2-diethyl-1,3-dioxolane-4-carboxylate |
| SMILES | C=CC=C(Cl)C(=C(C)Cl)C1OC(CC)(CC)OC1C(=O)OCC |
| InChI | InChI=1S/C17H24Cl2O4/c1-6-10-12(19)13(11(5)18)14-15(16(20)21-9-4)23-17(7-2,8-3)22-14/h6,10,14-15H,1,7-9H2,2-5H3 |
| InChIKey | JQZBAHVVNCPBNO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|