C18H20O4S — CID 123182803
1,5-dimethoxy-2-methylsulfonyl-4-(3-phenylprop-2-enyl)benzene (PubChem CID 123182803) has the molecular formula C18H20O4S and a molecular weight of 332.42 g/mol. Its IUPAC name is 1,5-dimethoxy-2-methylsulfonyl-4-(3-phenylprop-2-enyl)benzene.
| Compound Name | 1,5-dimethoxy-2-methylsulfonyl-4-(3-phenylprop-2-enyl)benzene |
|---|---|
| PubChem CID | 123182803 |
| Molecular Formula | C18H20O4S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1,5-dimethoxy-2-methylsulfonyl-4-(3-phenylprop-2-enyl)benzene |
| SMILES | COc1cc(OC)c(S(C)(=O)=O)cc1CC=Cc1ccccc1 |
| InChI | InChI=1S/C18H20O4S/c1-21-16-13-17(22-2)18(23(3,19)20)12-15(16)11-7-10-14-8-5-4-6-9-14/h4-10,12-13H,11H2,1-3H3 |
| InChIKey | ORYUQWDTNQCUFJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |