C22H29NO3 — CID 123182974
(3S)-3-benzyl-5-(diethylamino)-3-hydroxy-2-phenylpentanoic acid (PubChem CID 123182974) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is (3S)-3-benzyl-5-(diethylamino)-3-hydroxy-2-phenylpentanoic acid.
| Compound Name | (3S)-3-benzyl-5-(diethylamino)-3-hydroxy-2-phenylpentanoic acid |
|---|---|
| PubChem CID | 123182974 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (3S)-3-benzyl-5-(diethylamino)-3-hydroxy-2-phenylpentanoic acid |
| SMILES | CCN(CC)CC[C@@](O)(Cc1ccccc1)C(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C22H29NO3/c1-3-23(4-2)16-15-22(26,17-18-11-7-5-8-12-18)20(21(24)25)19-13-9-6-10-14-19/h5-14,20,26H,3-4,15-17H2,1-2H3,(H,24,25)/t20?,22-/m1/s1 |
| InChIKey | ALJWAWZTLYHUER-LWMIZPGFSA-N |
| XLogP | 3.56 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |