C16H24ClNO4 — CID 117067436
2-[2-(diethylamino)ethyl]-3-phenylbutanedioic acid;hydrochloride (PubChem CID 117067436) has the molecular formula C16H24ClNO4 and a molecular weight of 329.82 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethyl]-3-phenylbutanedioic acid;hydrochloride.
| Compound Name | 2-[2-(diethylamino)ethyl]-3-phenylbutanedioic acid;hydrochloride |
|---|---|
| PubChem CID | 117067436 |
| Molecular Formula | C16H24ClNO4 |
| Molecular Weight | 329.82 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-[2-(diethylamino)ethyl]-3-phenylbutanedioic acid;hydrochloride |
| SMILES | CCN(CC)CCC(C(=O)O)C(C(=O)O)c1ccccc1.Cl |
| InChI | InChI=1S/C16H23NO4.ClH/c1-3-17(4-2)11-10-13(15(18)19)14(16(20)21)12-8-6-5-7-9-12;/h5-9,13-14H,3-4,10-11H2,1-2H3,(H,18,19)(H,20,21);1H |
| InChIKey | LLSPAXPWOJIUHS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.82 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |