C17H30ClNO3 — CID 21117618
2-(diethylamino)ethanol;2-phenylpentanoic acid;hydrochloride (PubChem CID 21117618) has the molecular formula C17H30ClNO3 and a molecular weight of 331.88 g/mol. Its IUPAC name is 2-(diethylamino)ethanol;2-phenylpentanoic acid;hydrochloride.
| Compound Name | 2-(diethylamino)ethanol;2-phenylpentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 21117618 |
| Molecular Formula | C17H30ClNO3 |
| Molecular Weight | 331.88 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 2-(diethylamino)ethanol;2-phenylpentanoic acid;hydrochloride |
| SMILES | CCCC(C(=O)O)c1ccccc1.CCN(CC)CCO.Cl |
| InChI | InChI=1S/C11H14O2.C6H15NO.ClH/c1-2-6-10(11(12)13)9-7-4-3-5-8-9;1-3-7(4-2)5-6-8;/h3-5,7-8,10H,2,6H2,1H3,(H,12,13);8H,3-6H2,1-2H3;1H |
| InChIKey | AGFWWYJGEBAYGX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.88 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |