C12H20O — CID 123183468
2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-ol (PubChem CID 123183468) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 123183468 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-ol |
| SMILES | CC(C)C1=CC=CC(C(C)C)C1O |
| InChI | InChI=1S/C12H20O/c1-8(2)10-6-5-7-11(9(3)4)12(10)13/h5-10,12-13H,1-4H3 |
| InChIKey | BCXWAKSRTIWDIK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |