C8H12FN — CID 144628803
2-fluoro-3-propan-2-yl-1,2-dihydropyridine (PubChem CID 144628803) has the molecular formula C8H12FN and a molecular weight of 141.19 g/mol. Its IUPAC name is 2-fluoro-3-propan-2-yl-1,2-dihydropyridine.
| Compound Name | 2-fluoro-3-propan-2-yl-1,2-dihydropyridine |
|---|---|
| PubChem CID | 144628803 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 2-fluoro-3-propan-2-yl-1,2-dihydropyridine |
| SMILES | CC(C)C1=CC=CNC1F |
| InChI | InChI=1S/C8H12FN/c1-6(2)7-4-3-5-10-8(7)9/h3-6,8,10H,1-2H3 |
| InChIKey | ZCQVPWNEYGIAOV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|