About N-methyl-2-propan-2-ylcyclohepta-2,4,6-trien-1-amine
N-methyl-2-propan-2-ylcyclohepta-2,4,6-trien-1-amine (PubChem CID 45096214) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is N-methyl-2-propan-2-ylcyclohepta-2,4,6-trien-1-amine.
Analyze N-methyl-2-propan-2-ylcyclohepta-2,4,6-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-propan-2-ylcyclohepta-2,4,6-trien-1-amine?
The IUPAC name of N-methyl-2-propan-2-ylcyclohepta-2,4,6-trien-1-amine (CID 45096214) is N-methyl-2-propan-2-ylcyclohepta-2,4,6-trien-1-amine.
What is the SMILES notation for N-methyl-2-propan-2-ylcyclohepta-2,4,6-trien-1-amine?
The canonical SMILES for N-methyl-2-propan-2-ylcyclohepta-2,4,6-trien-1-amine is CNC1C=CC=CC=C1C(C)C.
What is the InChIKey of N-methyl-2-propan-2-ylcyclohepta-2,4,6-trien-1-amine?
The InChIKey is JJQIPDXTXMUSLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-9(2)10-7-5-4-6-8-11(10)12-3/h4-9,11-12H,1-3H3.
What are the key properties of N-methyl-2-propan-2-ylcyclohepta-2,4,6-trien-1-amine?
N-methyl-2-propan-2-ylcyclohepta-2,4,6-trien-1-amine has a molecular weight of 163.26 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-propan-2-ylcyclohepta-2,4,6-trien-1-amine is sourced from PubChem (CID 45096214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).