C24H35N3 — CID 123185498
1-(2,4a-dihydro-1H-benzo[7]annulen-6-yl)-2,3-dicyclohexylguanidine (PubChem CID 123185498) has the molecular formula C24H35N3 and a molecular weight of 365.57 g/mol. Its IUPAC name is 1-(2,4a-dihydro-1H-benzo[7]annulen-6-yl)-2,3-dicyclohexylguanidine.
| Compound Name | 1-(2,4a-dihydro-1H-benzo[7]annulen-6-yl)-2,3-dicyclohexylguanidine |
|---|---|
| PubChem CID | 123185498 |
| Molecular Formula | C24H35N3 |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 365.28 |
| IUPAC Name | 1-(2,4a-dihydro-1H-benzo[7]annulen-6-yl)-2,3-dicyclohexylguanidine |
| SMILES | C1=CC(N/C(=N/C2CCCCC2)NC2CCCCC2)=CC2C=CCCC2=C1 |
| InChI | InChI=1S/C24H35N3/c1-3-13-21(14-4-1)25-24(26-22-15-5-2-6-16-22)27-23-17-9-12-19-10-7-8-11-20(19)18-23/h8-9,11-12,17-18,20-22H,1-7,10,13-16H2,(H2,25,26,27) |
| InChIKey | KAZLFIUFEMWURS-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|