C19H31N3 — CID 123300544
1-cyclohexa-1,5-dien-1-yl-2,3-dicyclohexylguanidine (PubChem CID 123300544) has the molecular formula C19H31N3 and a molecular weight of 301.48 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-2,3-dicyclohexylguanidine.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-2,3-dicyclohexylguanidine |
|---|---|
| PubChem CID | 123300544 |
| Molecular Formula | C19H31N3 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.25 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-2,3-dicyclohexylguanidine |
| SMILES | C1=CC(N/C(=N/C2CCCCC2)NC2CCCCC2)=CCC1 |
| InChI | InChI=1S/C19H31N3/c1-4-10-16(11-5-1)20-19(21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18/h4,10-11,17-18H,1-3,5-9,12-15H2,(H2,20,21,22) |
| InChIKey | VTQGRKNHJXOBIJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|