C20H31N3 — CID 123994972
1-cyclohepta-1,3,6-trien-1-yl-2,3-dicyclohexylguanidine (PubChem CID 123994972) has the molecular formula C20H31N3 and a molecular weight of 313.49 g/mol. Its IUPAC name is 1-cyclohepta-1,3,6-trien-1-yl-2,3-dicyclohexylguanidine.
| Compound Name | 1-cyclohepta-1,3,6-trien-1-yl-2,3-dicyclohexylguanidine |
|---|---|
| PubChem CID | 123994972 |
| Molecular Formula | C20H31N3 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | 1-cyclohepta-1,3,6-trien-1-yl-2,3-dicyclohexylguanidine |
| SMILES | C1=CCC=CC(N/C(=N/C2CCCCC2)NC2CCCCC2)=C1 |
| InChI | InChI=1S/C20H31N3/c1-2-6-12-17(11-5-1)21-20(22-18-13-7-3-8-14-18)23-19-15-9-4-10-16-19/h1,5-6,11-12,18-19H,2-4,7-10,13-16H2,(H2,21,22,23) |
| InChIKey | NVHLICNFOQRLLY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|