C41H72 — CID 123189149
2-[2-[1-(2-butan-2-yl-4-methyl-1-bicyclo[1.1.0]butanyl)propyl]-4,7,8,10-tetramethylpentadeca-1,10-dienyl]-5-ethyl-2,6-dimethylspiro[2.3]hexane (PubChem CID 123189149) has the molecular formula C41H72 and a molecular weight of 565.03 g/mol. Its IUPAC name is 2-[2-[1-(2-butan-2-yl-4-methyl-1-bicyclo[1.1.0]butanyl)propyl]-4,7,8,10-tetramethylpentadeca-1,10-dienyl]-5-ethyl-2,6-dimethylspiro[2.3]hexane.
| Compound Name | 2-[2-[1-(2-butan-2-yl-4-methyl-1-bicyclo[1.1.0]butanyl)propyl]-4,7,8,10-tetramethylpentadeca-1,10-dienyl]-5-ethyl-2,6-dimethylspiro[2.3]hexane |
|---|---|
| PubChem CID | 123189149 |
| Molecular Formula | C41H72 |
| Molecular Weight | 565.03 g/mol |
| Exact Mass | 564.56 |
| IUPAC Name | 2-[2-[1-(2-butan-2-yl-4-methyl-1-bicyclo[1.1.0]butanyl)propyl]-4,7,8,10-tetramethylpentadeca-1,10-dienyl]-5-ethyl-2,6-dimethylspiro[2.3]hexane |
| SMILES | CCCCC=C(C)CC(C)C(C)CCC(C)CC(=CC1(C)CC12CC(CC)C2C)C(CC)C12C(C)C1C2C(C)CC |
| InChI | InChI=1S/C41H72/c1-13-17-18-19-27(5)22-31(9)30(8)21-20-28(6)23-35(24-39(12)26-40(39)25-34(15-3)32(40)10)36(16-4)41-33(11)38(41)37(41)29(7)14-2/h19,24,28-34,36-38H,13-18,20-23,25-26H2,1-12H3 |
| InChIKey | JBFTYHLNNRCLPJ-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.03 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|