C35H62 — CID 166593951
(1S)-1-(3-methylbut-2-enyl)-2-[2-[(1R,2R)-2-[(8E)-4,9,13,17-tetramethyloctadeca-8,16-dienyl]cyclopropyl]ethyl]cyclopropane (PubChem CID 166593951) has the molecular formula C35H62 and a molecular weight of 482.88 g/mol. Its IUPAC name is (1S)-1-(3-methylbut-2-enyl)-2-[2-[(1R,2R)-2-[(8E)-4,9,13,17-tetramethyloctadeca-8,16-dienyl]cyclopropyl]ethyl]cyclopropane.
| Compound Name | (1S)-1-(3-methylbut-2-enyl)-2-[2-[(1R,2R)-2-[(8E)-4,9,13,17-tetramethyloctadeca-8,16-dienyl]cyclopropyl]ethyl]cyclopropane |
|---|---|
| PubChem CID | 166593951 |
| Molecular Formula | C35H62 |
| Molecular Weight | 482.88 g/mol |
| Exact Mass | 482.49 |
| IUPAC Name | (1S)-1-(3-methylbut-2-enyl)-2-[2-[(1R,2R)-2-[(8E)-4,9,13,17-tetramethyloctadeca-8,16-dienyl]cyclopropyl]ethyl]cyclopropane |
| SMILES | CC(C)=CCCC(C)CCC/C(C)=C/CCCC(C)CCC[C@@H]1C[C@H]1CCC1C[C@H]1CC=C(C)C |
| InChI | InChI=1S/C35H62/c1-27(2)13-10-16-31(7)18-11-17-29(5)14-8-9-15-30(6)19-12-20-32-25-34(32)23-24-35-26-33(35)22-21-28(3)4/h13-14,21,30-35H,8-12,15-20,22-26H2,1-7H3/b29-14+/t30?,31?,32-,33-,34-,35?/m1/s1 |
| InChIKey | KISIVNDPYKBHRM-OPLGPRCFSA-N |
| XLogP | 11.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.88 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|