C13H20N2O — CID 123191055
3-ethyl-5-(3-oxabicyclo[3.1.0]hexan-6-yl)-1-propan-2-ylpyrazole (PubChem CID 123191055) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-ethyl-5-(3-oxabicyclo[3.1.0]hexan-6-yl)-1-propan-2-ylpyrazole.
| Compound Name | 3-ethyl-5-(3-oxabicyclo[3.1.0]hexan-6-yl)-1-propan-2-ylpyrazole |
|---|---|
| PubChem CID | 123191055 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 3-ethyl-5-(3-oxabicyclo[3.1.0]hexan-6-yl)-1-propan-2-ylpyrazole |
| SMILES | CCc1cc(C2C3COCC32)n(C(C)C)n1 |
| InChI | InChI=1S/C13H20N2O/c1-4-9-5-12(15(14-9)8(2)3)13-10-6-16-7-11(10)13/h5,8,10-11,13H,4,6-7H2,1-3H3 |
| InChIKey | OBZGOUDHOGKIAA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |