C19H18NS+ — CID 123191162
3-ethyl-3-methyl-12-thia-5-azoniapentacyclo[9.7.0.02,4.05,10.013,18]octadeca-1(11),5,7,9,13,15,17-heptaene (PubChem CID 123191162) has the molecular formula C19H18NS+ and a molecular weight of 292.43 g/mol. Its IUPAC name is 3-ethyl-3-methyl-12-thia-5-azoniapentacyclo[9.7.0.02,4.05,10.013,18]octadeca-1(11),5,7,9,13,15,17-heptaene.
| Compound Name | 3-ethyl-3-methyl-12-thia-5-azoniapentacyclo[9.7.0.02,4.05,10.013,18]octadeca-1(11),5,7,9,13,15,17-heptaene |
|---|---|
| PubChem CID | 123191162 |
| Molecular Formula | C19H18NS+ |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-ethyl-3-methyl-12-thia-5-azoniapentacyclo[9.7.0.02,4.05,10.013,18]octadeca-1(11),5,7,9,13,15,17-heptaene |
| SMILES | CCC1(C)C2c3c(sc4ccccc34)-c3cccc[n+]3C21 |
| InChI | InChI=1S/C19H18NS/c1-3-19(2)16-15-12-8-4-5-10-14(12)21-17(15)13-9-6-7-11-20(13)18(16)19/h4-11,16,18H,3H2,1-2H3/q+1 |
| InChIKey | AOJMUDJYTXAEBH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|