C31H28F5N5O2 — CID 123192313
N-[1-[3-[3-[amino(hydroxy)methyl]-4-fluorophenyl]-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]-2-[5-(difluoromethyl)-3,4-diazatricyclo[6.1.1.02,6]deca-2(6),4-dien-3-yl]acetamide (PubChem CID 123192313) has the molecular formula C31H28F5N5O2 and a molecular weight of 597.59 g/mol. Its IUPAC name is N-[1-[3-[3-[amino(hydroxy)methyl]-4-fluorophenyl]-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]-2-[5-(difluoromethyl)-3,4-diazatricyclo[6.1.1.02,6]deca-2(6),4-dien-3-yl]acetamide.
| Compound Name | N-[1-[3-[3-[amino(hydroxy)methyl]-4-fluorophenyl]-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]-2-[5-(difluoromethyl)-3,4-diazatricyclo[6.1.1.02,6]deca-2(6),4-dien-3-yl]acetamide |
|---|---|
| PubChem CID | 123192313 |
| Molecular Formula | C31H28F5N5O2 |
| Molecular Weight | 597.59 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | N-[1-[3-[3-[amino(hydroxy)methyl]-4-fluorophenyl]-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]-2-[5-(difluoromethyl)-3,4-diazatricyclo[6.1.1.02,6]deca-2(6),4-dien-3-yl]acetamide |
| SMILES | NC(O)c1cc(-c2cccnc2C(Cc2cc(F)cc(F)c2)NC(=O)Cn2nc(C(F)F)c3c2C2CC(C3)C2)ccc1F |
| InChI | InChI=1S/C31H28F5N5O2/c32-19-8-16(9-20(33)13-19)11-25(27-21(2-1-5-38-27)17-3-4-24(34)22(12-17)31(37)43)39-26(42)14-41-29-18-6-15(7-18)10-23(29)28(40-41)30(35)36/h1-5,8-9,12-13,15,18,25,30-31,43H,6-7,10-11,14,37H2,(H,39,42) |
| InChIKey | WWISASPHUBXQED-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|