C31H26F3N5O3 — CID 89351001
5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-(5-formyl-3,4-diazatricyclo[6.1.1.02,6]deca-2(6),4-dien-3-yl)acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide (PubChem CID 89351001) has the molecular formula C31H26F3N5O3 and a molecular weight of 573.58 g/mol. Its IUPAC name is 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-(5-formyl-3,4-diazatricyclo[6.1.1.02,6]deca-2(6),4-dien-3-yl)acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-(5-formyl-3,4-diazatricyclo[6.1.1.02,6]deca-2(6),4-dien-3-yl)acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 89351001 |
| Molecular Formula | C31H26F3N5O3 |
| Molecular Weight | 573.58 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-(5-formyl-3,4-diazatricyclo[6.1.1.02,6]deca-2(6),4-dien-3-yl)acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide |
| SMILES | NC(=O)c1cc(-c2cccnc2[C@H](Cc2cc(F)cc(F)c2)NC(=O)Cn2nc(C=O)c3c2C2CC(C3)C2)ccc1F |
| InChI | InChI=1S/C31H26F3N5O3/c32-20-8-17(9-21(33)13-20)11-26(29-22(2-1-5-36-29)18-3-4-25(34)23(12-18)31(35)42)37-28(41)14-39-30-19-6-16(7-19)10-24(30)27(15-40)38-39/h1-5,8-9,12-13,15-16,19,26H,6-7,10-11,14H2,(H2,35,42)(H,37,41)/t16?,19?,26-/m0/s1 |
| InChIKey | GNPVODPTBBOHDB-GTIOVZTQSA-N |
| XLogP | 4.42 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|