C26H39N3O5 — CID 123192492
tert-butyl 4-[[4-[4-(2-nitrosoethylcarbamoyl)cyclohexen-1-yl]cyclohexa-1,5-dien-1-yl]oxymethyl]piperidine-1-carboxylate (PubChem CID 123192492) has the molecular formula C26H39N3O5 and a molecular weight of 473.61 g/mol. Its IUPAC name is tert-butyl 4-[[4-[4-(2-nitrosoethylcarbamoyl)cyclohexen-1-yl]cyclohexa-1,5-dien-1-yl]oxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[4-(2-nitrosoethylcarbamoyl)cyclohexen-1-yl]cyclohexa-1,5-dien-1-yl]oxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123192492 |
| Molecular Formula | C26H39N3O5 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | tert-butyl 4-[[4-[4-(2-nitrosoethylcarbamoyl)cyclohexen-1-yl]cyclohexa-1,5-dien-1-yl]oxymethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(COC2=CCC(C3=CCC(C(=O)NCCN=O)CC3)C=C2)CC1 |
| InChI | InChI=1S/C26H39N3O5/c1-26(2,3)34-25(31)29-16-12-19(13-17-29)18-33-23-10-8-21(9-11-23)20-4-6-22(7-5-20)24(30)27-14-15-28-32/h4,8,10-11,19,21-22H,5-7,9,12-18H2,1-3H3,(H,27,30) |
| InChIKey | WWWXREINBKNKEB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|