C22H42 — CID 123194798
2-(3,5-dimethyldec-6-en-2-yl)-1,3-dimethyl-1-(3-methylbutyl)cyclopropane (PubChem CID 123194798) has the molecular formula C22H42 and a molecular weight of 306.58 g/mol. Its IUPAC name is 2-(3,5-dimethyldec-6-en-2-yl)-1,3-dimethyl-1-(3-methylbutyl)cyclopropane.
| Compound Name | 2-(3,5-dimethyldec-6-en-2-yl)-1,3-dimethyl-1-(3-methylbutyl)cyclopropane |
|---|---|
| PubChem CID | 123194798 |
| Molecular Formula | C22H42 |
| Molecular Weight | 306.58 g/mol |
| Exact Mass | 306.33 |
| IUPAC Name | 2-(3,5-dimethyldec-6-en-2-yl)-1,3-dimethyl-1-(3-methylbutyl)cyclopropane |
| SMILES | CCCC=CC(C)CC(C)C(C)C1C(C)C1(C)CCC(C)C |
| InChI | InChI=1S/C22H42/c1-9-10-11-12-17(4)15-18(5)19(6)21-20(7)22(21,8)14-13-16(2)3/h11-12,16-21H,9-10,13-15H2,1-8H3 |
| InChIKey | VROJVMMLLFCOGD-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.58 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|