C19H36 — CID 123521762
2-(2,4-dimethylhex-5-en-3-yl)-1,3-dimethyl-1-(3-methylpentyl)cyclopropane (PubChem CID 123521762) has the molecular formula C19H36 and a molecular weight of 264.50 g/mol. Its IUPAC name is 2-(2,4-dimethylhex-5-en-3-yl)-1,3-dimethyl-1-(3-methylpentyl)cyclopropane.
| Compound Name | 2-(2,4-dimethylhex-5-en-3-yl)-1,3-dimethyl-1-(3-methylpentyl)cyclopropane |
|---|---|
| PubChem CID | 123521762 |
| Molecular Formula | C19H36 |
| Molecular Weight | 264.50 g/mol |
| Exact Mass | 264.28 |
| IUPAC Name | 2-(2,4-dimethylhex-5-en-3-yl)-1,3-dimethyl-1-(3-methylpentyl)cyclopropane |
| SMILES | C=CC(C)C(C(C)C)C1C(C)C1(C)CCC(C)CC |
| InChI | InChI=1S/C19H36/c1-9-14(5)11-12-19(8)16(7)18(19)17(13(3)4)15(6)10-2/h10,13-18H,2,9,11-12H2,1,3-8H3 |
| InChIKey | FSKCMLDSZDPBRS-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.50 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|