C14H22 — CID 123196166
2,2-dimethyl-6-(2-methylcyclopropyl)-3-methylidenebicyclo[2.2.1]heptane (PubChem CID 123196166) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 2,2-dimethyl-6-(2-methylcyclopropyl)-3-methylidenebicyclo[2.2.1]heptane.
| Compound Name | 2,2-dimethyl-6-(2-methylcyclopropyl)-3-methylidenebicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 123196166 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 2,2-dimethyl-6-(2-methylcyclopropyl)-3-methylidenebicyclo[2.2.1]heptane |
| SMILES | C=C1C2CC(C3CC3C)C(C2)C1(C)C |
| InChI | InChI=1S/C14H22/c1-8-5-11(8)12-6-10-7-13(12)14(3,4)9(10)2/h8,10-13H,2,5-7H2,1,3-4H3 |
| InChIKey | XRIANBMGTYWLHW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|