C22H19FN5OS+ — CID 123196246
4-[2-[6-(6-fluoro-3-pyridinyl)-3,3,4-trimethyl-2-oxo-1,6-dihydropyrimidin-3-ium-5-yl]-1,3-thiazol-4-yl]benzonitrile (PubChem CID 123196246) has the molecular formula C22H19FN5OS+ and a molecular weight of 420.49 g/mol. Its IUPAC name is 4-[2-[6-(6-fluoro-3-pyridinyl)-3,3,4-trimethyl-2-oxo-1,6-dihydropyrimidin-3-ium-5-yl]-1,3-thiazol-4-yl]benzonitrile.
| Compound Name | 4-[2-[6-(6-fluoro-3-pyridinyl)-3,3,4-trimethyl-2-oxo-1,6-dihydropyrimidin-3-ium-5-yl]-1,3-thiazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 123196246 |
| Molecular Formula | C22H19FN5OS+ |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 4-[2-[6-(6-fluoro-3-pyridinyl)-3,3,4-trimethyl-2-oxo-1,6-dihydropyrimidin-3-ium-5-yl]-1,3-thiazol-4-yl]benzonitrile |
| SMILES | CC1=C(c2nc(-c3ccc(C#N)cc3)cs2)C(c2ccc(F)nc2)NC(=O)[N+]1(C)C |
| InChI | InChI=1S/C22H18FN5OS/c1-13-19(21-26-17(12-30-21)15-6-4-14(10-24)5-7-15)20(27-22(29)28(13,2)3)16-8-9-18(23)25-11-16/h4-9,11-12,20H,1-3H3/p+1 |
| InChIKey | PUJDYVUWJNDFGX-UHFFFAOYSA-O |
| XLogP | 4.49 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|