C21H16N4O3S — CID 71505727
4-[2-[4-(3,4-dihydroxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidin-5-yl]-1,3-thiazol-4-yl]benzonitrile (PubChem CID 71505727) has the molecular formula C21H16N4O3S and a molecular weight of 404.45 g/mol. Its IUPAC name is 4-[2-[4-(3,4-dihydroxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidin-5-yl]-1,3-thiazol-4-yl]benzonitrile.
| Compound Name | 4-[2-[4-(3,4-dihydroxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidin-5-yl]-1,3-thiazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 71505727 |
| Molecular Formula | C21H16N4O3S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 4-[2-[4-(3,4-dihydroxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidin-5-yl]-1,3-thiazol-4-yl]benzonitrile |
| SMILES | CC1=C(c2nc(-c3ccc(C#N)cc3)cs2)C(c2ccc(O)c(O)c2)NC(=O)N1 |
| InChI | InChI=1S/C21H16N4O3S/c1-11-18(19(25-21(28)23-11)14-6-7-16(26)17(27)8-14)20-24-15(10-29-20)13-4-2-12(9-22)3-5-13/h2-8,10,19,26-27H,1H3,(H2,23,25,28) |
| InChIKey | ZMJONQOHUCLURS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 118.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|