C26H22N4O2S — CID 89427160
5-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-6-methyl-4-(4-phenoxyphenyl)-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 89427160) has the molecular formula C26H22N4O2S and a molecular weight of 454.56 g/mol. Its IUPAC name is 5-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-6-methyl-4-(4-phenoxyphenyl)-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | 5-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-6-methyl-4-(4-phenoxyphenyl)-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 89427160 |
| Molecular Formula | C26H22N4O2S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 5-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-6-methyl-4-(4-phenoxyphenyl)-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | CC1=C(c2nc(-c3ccc(N)cc3)cs2)C(c2ccc(Oc3ccccc3)cc2)NC(=O)N1 |
| InChI | InChI=1S/C26H22N4O2S/c1-16-23(25-29-22(15-33-25)17-7-11-19(27)12-8-17)24(30-26(31)28-16)18-9-13-21(14-10-18)32-20-5-3-2-4-6-20/h2-15,24H,27H2,1H3,(H2,28,30,31) |
| InChIKey | CUDPASSZWJFXEW-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|