C19H15Cl2N5OS — CID 89427132
5-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-4-(2,6-dichloro-3-pyridinyl)-6-methyl-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 89427132) has the molecular formula C19H15Cl2N5OS and a molecular weight of 432.34 g/mol. Its IUPAC name is 5-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-4-(2,6-dichloro-3-pyridinyl)-6-methyl-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | 5-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-4-(2,6-dichloro-3-pyridinyl)-6-methyl-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 89427132 |
| Molecular Formula | C19H15Cl2N5OS |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | 5-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-4-(2,6-dichloro-3-pyridinyl)-6-methyl-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | CC1=C(c2nc(-c3ccc(N)cc3)cs2)C(c2ccc(Cl)nc2Cl)NC(=O)N1 |
| InChI | InChI=1S/C19H15Cl2N5OS/c1-9-15(18-24-13(8-28-18)10-2-4-11(22)5-3-10)16(26-19(27)23-9)12-6-7-14(20)25-17(12)21/h2-8,16H,22H2,1H3,(H2,23,26,27) |
| InChIKey | VDDWAYSWTRZOEP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|