C16H8I2N4S2 — CID 123197189
(18-hydrazinylidene-6,15-diiodo-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-9-ylidene)hydrazine (PubChem CID 123197189) has the molecular formula C16H8I2N4S2 and a molecular weight of 574.21 g/mol. Its IUPAC name is (18-hydrazinylidene-6,15-diiodo-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-9-ylidene)hydrazine.
| Compound Name | (18-hydrazinylidene-6,15-diiodo-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-9-ylidene)hydrazine |
|---|---|
| PubChem CID | 123197189 |
| Molecular Formula | C16H8I2N4S2 |
| Molecular Weight | 574.21 g/mol |
| Exact Mass | 573.83 |
| IUPAC Name | (18-hydrazinylidene-6,15-diiodo-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-9-ylidene)hydrazine |
| SMILES | NN=c1c2cc3c(cc2c2sc(I)cc12)c(=NN)c1cc(I)sc13 |
| InChI | InChI=1S/C16H8I2N4S2/c17-11-4-10-14(22-20)6-2-8-5(1-7(6)15(10)23-11)13(21-19)9-3-12(18)24-16(8)9/h1-4H,19-20H2 |
| InChIKey | BIXFDGNRQDGSIT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.21 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|