C28H16I2N4S2 — CID 123270979
N-[[6,15-diiodo-18-(phenylhydrazinylidene)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-9-ylidene]amino]aniline (PubChem CID 123270979) has the molecular formula C28H16I2N4S2 and a molecular weight of 726.41 g/mol. Its IUPAC name is N-[[6,15-diiodo-18-(phenylhydrazinylidene)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-9-ylidene]amino]aniline.
| Compound Name | N-[[6,15-diiodo-18-(phenylhydrazinylidene)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-9-ylidene]amino]aniline |
|---|---|
| PubChem CID | 123270979 |
| Molecular Formula | C28H16I2N4S2 |
| Molecular Weight | 726.41 g/mol |
| Exact Mass | 725.89 |
| IUPAC Name | N-[[6,15-diiodo-18-(phenylhydrazinylidene)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-9-ylidene]amino]aniline |
| SMILES | Ic1cc2c(=NNc3ccccc3)c3cc4c(cc3c2s1)c(=NNc1ccccc1)c1cc(I)sc14 |
| InChI | InChI=1S/C28H16I2N4S2/c29-23-13-21-25(33-31-15-7-3-1-4-8-15)17-11-20-18(12-19(17)27(21)35-23)26(22-14-24(30)36-28(20)22)34-32-16-9-5-2-6-10-16/h1-14,31-32H |
| InChIKey | XWDGMRWLJDQIDA-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.41 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|