C51H52 — CID 123197795
7-tert-butyl-3-[4-[6-(9,9-dimethyl-3,4-dihydrofluoren-2-yl)-3,4,7,8-tetrahydronaphthalen-2-yl]cyclohexa-1,3-dien-1-yl]-1,2,8a,10c-tetrahydropyrene (PubChem CID 123197795) has the molecular formula C51H52 and a molecular weight of 664.98 g/mol. Its IUPAC name is 7-tert-butyl-3-[4-[6-(9,9-dimethyl-3,4-dihydrofluoren-2-yl)-3,4,7,8-tetrahydronaphthalen-2-yl]cyclohexa-1,3-dien-1-yl]-1,2,8a,10c-tetrahydropyrene.
| Compound Name | 7-tert-butyl-3-[4-[6-(9,9-dimethyl-3,4-dihydrofluoren-2-yl)-3,4,7,8-tetrahydronaphthalen-2-yl]cyclohexa-1,3-dien-1-yl]-1,2,8a,10c-tetrahydropyrene |
|---|---|
| PubChem CID | 123197795 |
| Molecular Formula | C51H52 |
| Molecular Weight | 664.98 g/mol |
| Exact Mass | 664.41 |
| IUPAC Name | 7-tert-butyl-3-[4-[6-(9,9-dimethyl-3,4-dihydrofluoren-2-yl)-3,4,7,8-tetrahydronaphthalen-2-yl]cyclohexa-1,3-dien-1-yl]-1,2,8a,10c-tetrahydropyrene |
| SMILES | CC(C)(C)C1=CC2C=CC3=C4C(=C(C5=CC=C(C6=CC7=C(C=C(C8=CC9=C(CC8)c8ccccc8C9(C)C)CC7)CC6)CC5)CC3)C=CC(=C1)C42 |
| InChI | InChI=1S/C51H52/c1-50(2,3)41-28-39-19-14-33-20-23-42(45-25-22-40(29-41)48(39)49(33)45)32-12-10-31(11-13-32)34-15-16-36-27-37(18-17-35(36)26-34)38-21-24-44-43-8-6-7-9-46(43)51(4,5)47(44)30-38/h6-10,12,14,19,22,25-30,39,48H,11,13,15-18,20-21,23-24H2,1-5H3 |
| InChIKey | BBTGRWXWZOZJSZ-UHFFFAOYSA-N |
| XLogP | 13.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.98 |
| LogP ≤ 5 | 13.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |